3-Bromo-6-chloroimidazo[1,2-a]pyrimidine, 97%
cas: 944906-48-3 — see every product listed under this CAS number, including other names
3-Bromo-6-chloroimidazo[1,2-a]pyrimidine, 97% (CAS 944906-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A286552-100mg |
| cas | 944906-48-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 2517.50 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1854.80 Pln | |
| Chemat | 10g | 3578.00 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 2707.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-6-chloroimidazo[1,2-a]pyrimidine (CAS 944906-48-3) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-6-chloroimidazo[1,2-a]pyrimidine. InChIKey: ZNNVAIVBZLXARY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-6-chloroimidazo[1,2-a]pyrimidine |
| InChIKey | ZNNVAIVBZLXARY-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(C=NC2=N1)Cl)Br |
Computed by PubChem (NCBI)