cas: 143591-61-1 — see every product listed under this CAS number, including other names
3-Bromo-8-chloroimidazo[1,2-a]pyrazine, 95% (CAS 143591-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076069-1G |
| cas | 143591-61-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 1096.51 Pln | |
| Fluorochem | 100g | 3543.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-8-chloroimidazo[1,2-a]pyrazine (CAS 143591-61-1) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-8-chloroimidazo[1,2-a]pyrazine. InChIKey: MCEGPQSPRNOFMG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-8-chloroimidazo[1,2-a]pyrazine |
| InChIKey | MCEGPQSPRNOFMG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=N1)Cl)Br |
Computed by PubChem (NCBI)