cas: 337535-74-7 — see every product listed under this CAS number, including other names
3-Bromo-N-cyclopropylbenzamide, 98%, 98% (CAS 337535-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9TH-100mg |
| cas | 337535-74-7 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 10g | 1125.20 Pln | |
| Chemat | 25g | 1974.80 Pln | |
| Chemat | 100g | 5166.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-N-cyclopropylbenzamide (CAS 337535-74-7) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 3-bromo-N-cyclopropylbenzamide. InChIKey: TZOROVSHSRTGHY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 3-bromo-N-cyclopropylbenzamide |
| InChIKey | TZOROVSHSRTGHY-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)