CAS 1105187-44-7 appears in our catalog under these names: 4-(3-Bromophenyl)pyrrolidin-2-one, 95%, 4–(3–Bromophenyl)pyrrolidin–2–one, 4-(3-Bromophenyl)pyrrolidin-2-one. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-(3-bromophenyl)pyrrolidin-2-one (CAS 1105187-44-7) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-(3-bromophenyl)pyrrolidin-2-one. InChIKey: OKCQAQCUYZLTCI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-(3-bromophenyl)pyrrolidin-2-one |
| InChIKey | OKCQAQCUYZLTCI-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)