CAS 306745-64-2 appears in our catalog under these names: N-Cyclopropyl 4-bromobenzamide, 97%, 4–Bromo–N–cyclopropylbenzamide, N-Cyclopropyl 4-bromobenzamide, N-Cyclopropyl 4-bromobenzamide, 98%, 98%, 4-Bromo-N-cyclopropylbenzamide, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
4-bromo-N-cyclopropylbenzamide (CAS 306745-64-2) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-bromo-N-cyclopropylbenzamide. InChIKey: PTAOXRHPDPMIBL-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-bromo-N-cyclopropylbenzamide |
| InChIKey | PTAOXRHPDPMIBL-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)