cas: 29174-66-1 — see every product listed under this CAS number, including other names
3-Bromobenzo[b]thiophene-2-carboxylic acid, 95%, 95% (CAS 29174-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XKS-100mg |
| cas | 29174-66-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 500mg | 405.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-1-benzothiophene-2-carboxylic acid (CAS 29174-66-1) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 3-bromo-1-benzothiophene-2-carboxylic acid. InChIKey: UDLGTTKXEYIEMM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 3-bromo-1-benzothiophene-2-carboxylic acid |
| InChIKey | UDLGTTKXEYIEMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)O)Br |
Computed by PubChem (NCBI)