CAS 7312-24-5 appears in our catalog under these names: 5-Bromo-1-benzothiophene-3-carboxylic acid, 5-Bromobenzo[b]thiophene-3-carboxylic acid, 98%, 5-Bromobenzo[b]thiophene-3-carboxylic acid, 97% , 5-Bromobenzo[b]thiophene-3-carboxylic acid 98%, 5-Bromobenzo[b]thiophene-3-carboxylic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250MG, 100mg.
5-bromo-1-benzothiophene-3-carboxylic acid (CAS 7312-24-5) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 5-bromo-1-benzothiophene-3-carboxylic acid. InChIKey: DWQBOPASRUUSKR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-bromo-1-benzothiophene-3-carboxylic acid |
| InChIKey | DWQBOPASRUUSKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)