cas: 29174-66-1 — see every product listed under this CAS number, including other names
3-Bromo-1-benzothiophene-2-carboxylic acid, 95% (CAS 29174-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F639754-250MG |
| cas | 29174-66-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 500mg | 508.17 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 2.5g | 1320.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-1-benzothiophene-2-carboxylic acid (CAS 29174-66-1) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 3-bromo-1-benzothiophene-2-carboxylic acid. InChIKey: UDLGTTKXEYIEMM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 3-bromo-1-benzothiophene-2-carboxylic acid |
| InChIKey | UDLGTTKXEYIEMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)O)Br |
Computed by PubChem (NCBI)