cas: 2113-57-7 — see every product listed under this CAS number, including other names
3-Bromobiphenyl, 97% (CAS 2113-57-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 339100010 |
| cas | 2113-57-7 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 245.44 Pln | |
| Thermo Scientific (Acros) | 5g | 815.16 Pln | |
| Sigma-Aldrich | 5G | 232.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-bromo-3-phenylbenzene (CAS 2113-57-7) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 1-bromo-3-phenylbenzene. InChIKey: USYQKCQEVBFJRP-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 1-bromo-3-phenylbenzene |
| InChIKey | USYQKCQEVBFJRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)