CAS 5209-31-4 is the registry number for 3-Bromo-1,2-dihydroacenapthylene. Offered by: TRC. Available pack sizes: 100mg.
3-bromo-1,2-dihydroacenaphthylene (CAS 5209-31-4) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 3-bromo-1,2-dihydroacenaphthylene. InChIKey: ZCKOLZGEKZZPDE-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 3-bromo-1,2-dihydroacenaphthylene |
| InChIKey | ZCKOLZGEKZZPDE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2C1=CC=C3)Br |
Computed by PubChem (NCBI)