CAS 1219691-16-3 is the registry number for 2-Bromo-7-vinylnaphthalene, 95% +(stabilized with MEHQ). Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-bromo-7-ethenylnaphthalene (CAS 1219691-16-3) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 2-bromo-7-ethenylnaphthalene. InChIKey: BYCATLDSVRNLFJ-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 2-bromo-7-ethenylnaphthalene |
| InChIKey | BYCATLDSVRNLFJ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)