cas: 116632-57-6 — see every product listed under this CAS number, including other names
3-Bromoquinolin-5-amine, 95%, 95% (CAS 116632-57-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CWZ-250mg |
| cas | 116632-57-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 10g | 1355.60 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromoquinolin-5-amine (CAS 116632-57-6) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 3-bromoquinolin-5-amine. InChIKey: SVPUHAUIBLBKOQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 3-bromoquinolin-5-amine |
| InChIKey | SVPUHAUIBLBKOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(C=NC2=C1)Br)N |
Computed by PubChem (NCBI)