CAS 791626-58-9 appears in our catalog under these names: 6-Bromo-2-quinolinamine, 95%, 6-Bromoquinolin-2-amine, 98%, 98%, 2-Amino-6-bromoquinoline, 98%, 6-Bromoquinolin-2-amine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 25g, 100g, 250g.
6-bromoquinolin-2-amine (CAS 791626-58-9) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 6-bromoquinolin-2-amine. InChIKey: GSKICCPQEZRQEC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 6-bromoquinolin-2-amine |
| InChIKey | GSKICCPQEZRQEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1Br |
Computed by PubChem (NCBI)