CAS 1934465-17-4 appears in our catalog under these names: 5-Bromoquinolin-7-amine, 95%, 5-Bromoquinolin-7-amine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-bromoquinolin-7-amine (CAS 1934465-17-4) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 5-bromoquinolin-7-amine. InChIKey: ZKNUGXMIWACQQC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 5-bromoquinolin-7-amine |
| InChIKey | ZKNUGXMIWACQQC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2Br)N)N=C1 |
Computed by PubChem (NCBI)