cas: 1434142-13-8 — see every product listed under this CAS number, including other names
3-CBZ-6-OXO-3-AZABICYCLO[3.1.1]HEPTANE, 95+%, 95+% (CAS 1434142-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWX7-100mg |
| cas | 1434142-13-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 500mg | 1038.80 Pln | |
| Chemat | 1g | 1715.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate (CAS 1434142-13-8) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate. InChIKey: TYGFNYVBAIHYBE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate |
| InChIKey | TYGFNYVBAIHYBE-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C2=O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)