cas: 1434142-13-8 — see every product listed under this CAS number, including other names
Benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate 95+% (CAS 1434142-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A901815-100mg |
| cas | 1434142-13-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 2083.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A901815 |
Benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate (CAS 1434142-13-8) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate. InChIKey: TYGFNYVBAIHYBE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | benzyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate |
| InChIKey | TYGFNYVBAIHYBE-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C2=O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)