CAS 342611-01-2 appears in our catalog under these names: Propafenone Impurity 2-d5, 3-Chloro-1,2-propanediol-d5 (10 ug/mL in methanol), 3-Chloro-1,2-propanediol-d5, >95% (GC), (±)-3-Chloro-1,2-propane-d5-diol, 98 atom % D, min 97% Chemical Purity, 3-Chloro-1,2-propanediol D5. Offered by: Chemat Brand, TRC, CDN, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 20x1ml, 100mg, 10mg, 0,1g, 25mg, 50mg, 1x25mg.
3-chloro-1,1,2,3,3-pentadeuteriopropane-1,2-diol (CAS 342611-01-2) is a chemical compound with the molecular formula C3H7ClO2 and a molecular weight of 115.57 g/mol. IUPAC name: 3-chloro-1,1,2,3,3-pentadeuteriopropane-1,2-diol. InChIKey: SSZWWUDQMAHNAQ-UXXIZXEISA-N.
| Molecular formula | C3H7ClO2 |
|---|---|
| Molecular weight | 115.57 g/mol |
| IUPAC name | 3-chloro-1,1,2,3,3-pentadeuteriopropane-1,2-diol |
| InChIKey | SSZWWUDQMAHNAQ-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)O)O |
Computed by PubChem (NCBI)