3-Chloro-1-(3,4-dichlorophenyl)propan-1-one, 97%
cas: 35857-66-0 — see every product listed under this CAS number, including other names
3-Chloro-1-(3,4-dichlorophenyl)propan-1-one, 97% (CAS 35857-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A350933-100mg |
| cas | 35857-66-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1544.06 Pln | |
| Ambeed | 10g | 2656.56 Pln | |
| Ambeed | 25g | 5243.12 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1663.88 Pln | |
| BLDpharm | 10g | 2857.91 Pln | |
| BLDpharm | 25g | 5651.37 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-1-(3,4-dichlorophenyl)propan-1-one (CAS 35857-66-0) is a chemical compound with the molecular formula C9H7Cl3O and a molecular weight of 237.5 g/mol. IUPAC name: 3-chloro-1-(3,4-dichlorophenyl)propan-1-one. InChIKey: ULARDXFALKMJAJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 3-chloro-1-(3,4-dichlorophenyl)propan-1-one |
| InChIKey | ULARDXFALKMJAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCCl)Cl)Cl |
Computed by PubChem (NCBI)
