CAS 1824052-19-8 is the registry number for 1-(2,3,5-Trichlorophenyl)propan-1-one, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,3,5-trichlorophenyl)propan-1-one (CAS 1824052-19-8) is a chemical compound with the molecular formula C9H7Cl3O and a molecular weight of 237.5 g/mol. IUPAC name: 1-(2,3,5-trichlorophenyl)propan-1-one. InChIKey: BOMCCLSSGLKVSU-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 1-(2,3,5-trichlorophenyl)propan-1-one |
| InChIKey | BOMCCLSSGLKVSU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC(=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)