Products 116316-58-6
CAS 116316-58-6 is the registry number for 1-Chloro-3-(2,6-dichlorophenyl)propan-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-chloro-3-(2,6-dichlorophenyl)propan-2-one (CAS 116316-58-6) is a chemical compound with the molecular formula C9H7Cl3O and a molecular weight of 237.5 g/mol. IUPAC name: 1-chloro-3-(2,6-dichlorophenyl)propan-2-one. InChIKey: DLTURKWIGYRHHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 1-chloro-3-(2,6-dichlorophenyl)propan-2-one |
| InChIKey | DLTURKWIGYRHHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)CCl)Cl |
Computed by PubChem (NCBI)