cas: 1160573-14-7 — see every product listed under this CAS number, including other names
3-Chloro-2,4,6-trifluorobenzaldehyde (CAS 1160573-14-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037591-1G |
| cas | 1160573-14-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2851.10 Pln | |
| Fluorochem | 5g | 8432.47 Pln |
| delivery time | 3-4 weeks |
|---|
3-chloro-2,4,6-trifluorobenzaldehyde (CAS 1160573-14-7) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 3-chloro-2,4,6-trifluorobenzaldehyde. InChIKey: LGBHJSUWGHTAOV-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 3-chloro-2,4,6-trifluorobenzaldehyde |
| InChIKey | LGBHJSUWGHTAOV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)C=O)F |
Computed by PubChem (NCBI)