CAS 157373-08-5 appears in our catalog under these names: 2,3,4-Trifluorobenzoyl chloride, 95%, 2,3,4-Trifluorobenzoyl Chloride, 2,3,4–Trifluorobenzoyl Chloride, 2,3,4-Trifluorobenzoyl Chloride, >98.0%(T), 2,3,4-trifluorobenzoylchloride 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 2g, 500mg.
2,3,4-trifluorobenzoyl chloride (CAS 157373-08-5) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 2,3,4-trifluorobenzoyl chloride. InChIKey: NXRQXCFBZGIRGN-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoyl chloride |
| InChIKey | NXRQXCFBZGIRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)F)F |
Computed by PubChem (NCBI)