CAS 1160573-14-7 is the registry number for 3-Chloro-2,4,6-trifluorobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-chloro-2,4,6-trifluorobenzaldehyde (CAS 1160573-14-7) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 3-chloro-2,4,6-trifluorobenzaldehyde. InChIKey: LGBHJSUWGHTAOV-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 3-chloro-2,4,6-trifluorobenzaldehyde |
| InChIKey | LGBHJSUWGHTAOV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)C=O)F |
Computed by PubChem (NCBI)