3-Chloro-2-iodobenzoic acid, 97%
cas: 123278-03-5 — see every product listed under this CAS number, including other names
3-Chloro-2-iodobenzoic acid, 97% (CAS 123278-03-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111K0J-250mg |
| cas | 123278-03-5 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 25g | 923.60 Pln | |
| Chemat | 100g | 3501.20 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 794.53 Pln | |
| Fluorochem | 25g | 1575.50 Pln | |
| Fluorochem | 100g | 4912.87 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-chloro-2-iodobenzoic acid (CAS 123278-03-5) is a chemical compound with the molecular formula C7H4ClIO2 and a molecular weight of 282.46 g/mol. IUPAC name: 3-chloro-2-iodobenzoic acid. InChIKey: IHSNWQTZBUIFSL-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIO2 |
|---|---|
| Molecular weight | 282.46 g/mol |
| IUPAC name | 3-chloro-2-iodobenzoic acid |
| InChIKey | IHSNWQTZBUIFSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)I)C(=O)O |
Computed by PubChem (NCBI)