cas: 957060-88-7 — see every product listed under this CAS number, including other names
3-Chloro-2-methoxypyridine-4-boronic acid, 95% (CAS 957060-88-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250MG. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 448770010 |
| cas | 957060-88-7 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 761.71 Pln | |
| Thermo Scientific (Acros) | 250MG | 269.05 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
(3-chloro-2-methoxy-4-pyridinyl)boronic acid (CAS 957060-88-7) is a chemical compound with the molecular formula C6H7BClNO3 and a molecular weight of 187.39 g/mol. IUPAC name: (3-chloro-2-methoxy-4-pyridinyl)boronic acid. InChIKey: YQNAXOGPSUVHNU-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | (3-chloro-2-methoxy-4-pyridinyl)boronic acid |
| InChIKey | YQNAXOGPSUVHNU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)Cl)(O)O |
Computed by PubChem (NCBI)