cas: 869942-76-7 — see every product listed under this CAS number, including other names
3-Chloro-4-(1h-imidazol-1-yl)aniline, 97%, 97% (CAS 869942-76-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115KEB-250mg |
| cas | 869942-76-7 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 746.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-imidazol-1-ylaniline (CAS 869942-76-7) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 3-chloro-4-imidazol-1-ylaniline. InChIKey: QWZGGODEZYBJKU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 3-chloro-4-imidazol-1-ylaniline |
| InChIKey | QWZGGODEZYBJKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)N2C=CN=C2 |
Computed by PubChem (NCBI)