CAS 384844-04-6 appears in our catalog under these names: 5-Chloro-2,3-dimethylpyrido[3,4-b]pyrazine, 95%, 5–Chloro–2,3–dimethylpyrido(3,4–b)pyrazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
5-chloro-2,3-dimethylpyrido[3,4-b]pyrazine (CAS 384844-04-6) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 5-chloro-2,3-dimethylpyrido[3,4-b]pyrazine. InChIKey: NEHGKUBKQVDTSV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 5-chloro-2,3-dimethylpyrido[3,4-b]pyrazine |
| InChIKey | NEHGKUBKQVDTSV-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C=CN=C2Cl)C |
Computed by PubChem (NCBI)