CAS 78622-06-7 is the registry number for (1Z)-2-(3-Chlorophenyl)-n'-cyanoethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(3-chlorophenyl)-N'-cyanoethanimidamide (CAS 78622-06-7) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 2-(3-chlorophenyl)-N'-cyanoethanimidamide. InChIKey: JIHILOFXSSKHGR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-N'-cyanoethanimidamide |
| InChIKey | JIHILOFXSSKHGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(=NC#N)N |
Computed by PubChem (NCBI)