cas: 524955-09-7 — see every product listed under this CAS number, including other names
3-Chloro-4-(pyridin-2-ylmethoxy)aniline, 95%, 95% (CAS 524955-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0E9-250mg |
| cas | 524955-09-7 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 218.00 Pln | |
| Chemat | 100g | 520.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-(pyridin-2-ylmethoxy)aniline (CAS 524955-09-7) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 3-chloro-4-(pyridin-2-ylmethoxy)aniline. InChIKey: XCAPJQSICQSUJP-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
| InChIKey | XCAPJQSICQSUJP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)