CAS 353241-43-7 is the registry number for 1-(3-Chlorobenzoyl)-3,5-dimethyl-1h-pyrazole, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-chlorophenyl)-(3,5-dimethylpyrazol-1-yl)methanone (CAS 353241-43-7) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: (3-chlorophenyl)-(3,5-dimethylpyrazol-1-yl)methanone. InChIKey: KUMAPKSXVRZRRF-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | (3-chlorophenyl)-(3,5-dimethylpyrazol-1-yl)methanone |
| InChIKey | KUMAPKSXVRZRRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=O)C2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)