CAS 207992-39-0 appears in our catalog under these names: N-Allyl-n-(2-chloro-5-cyanophenyl)acetamide, 95%, N-Allyl-n-(2-chloro-5-cyanophenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
N-(2-chloro-5-cyanophenyl)-N-prop-2-enylacetamide (CAS 207992-39-0) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: N-(2-chloro-5-cyanophenyl)-N-prop-2-enylacetamide. InChIKey: TWJIDJOXVLIPBW-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | N-(2-chloro-5-cyanophenyl)-N-prop-2-enylacetamide |
| InChIKey | TWJIDJOXVLIPBW-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CC=C)C1=C(C=CC(=C1)C#N)Cl |
Computed by PubChem (NCBI)