cas: 141738-80-9 — see every product listed under this CAS number, including other names
3-Chloro-4-iodobenzotrifluoride, 95% (stabilized with Copper chip), 95% (stabilized with Copper chip) (CAS 141738-80-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GYB-250mg |
| cas | 141738-80-9 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 213.20 Pln |
| purity | 95% (stabilized with Copper chip) |
|---|---|
| delivery time | 3 weeks |
2-chloro-1-iodo-4-(trifluoromethyl)benzene (CAS 141738-80-9) is a chemical compound with the molecular formula C7H3ClF3I and a molecular weight of 306.45 g/mol. IUPAC name: 2-chloro-1-iodo-4-(trifluoromethyl)benzene. InChIKey: ULJRBVGSKAKZKQ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3I |
|---|---|
| Molecular weight | 306.45 g/mol |
| IUPAC name | 2-chloro-1-iodo-4-(trifluoromethyl)benzene |
| InChIKey | ULJRBVGSKAKZKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)I |
Computed by PubChem (NCBI)