CAS 213598-07-3 appears in our catalog under these names: 3-Chloro-4-Isopropoxybenzoic Acid, 3–Chloro–4–isopropoxybenzoic Acid, 3-Chloro-4-isopropoxybenzoic acid, 98%, 3-Chloro-4-isopropoxybenzoic Acid, 98%, 98%. Offered by: Chemat Brand, GLPBio, Fluorochem, Chemat. Available pack sizes: on request, 1g, 5g, 10g, 25g, 250mg, 100mg.
3-chloro-4-propan-2-yloxybenzoic acid (CAS 213598-07-3) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 3-chloro-4-propan-2-yloxybenzoic acid. InChIKey: QXSPLPLQLJAPSM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 3-chloro-4-propan-2-yloxybenzoic acid |
| InChIKey | QXSPLPLQLJAPSM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)