3-Chloro-4-trifluoromethoxyphenol, 98%
cas: 1000339-94-5 — see every product listed under this CAS number, including other names
3-Chloro-4-trifluoromethoxyphenol, 98% (CAS 1000339-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078028-250MG |
| cas | 1000339-94-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 10g | 664.37 Pln | |
| Fluorochem | 25g | 1039.24 Pln | |
| Fluorochem | 50g | 1877.48 Pln | |
| Fluorochem | 100g | 3345.71 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-4-(trifluoromethoxy)phenol (CAS 1000339-94-5) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 3-chloro-4-(trifluoromethoxy)phenol. InChIKey: ZDKAPCMMTRJKTR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethoxy)phenol |
| InChIKey | ZDKAPCMMTRJKTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)