cas: 37900-81-5 — see every product listed under this CAS number, including other names
3-Chloro-4-trifluoromethylphenol, 95% (CAS 37900-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230744-250MG |
| cas | 37900-81-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 695.61 Pln | |
| Fluorochem | 10g | 1341.21 Pln | |
| Fluorochem | 25g | 3012.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-4-(trifluoromethyl)phenol (CAS 37900-81-5) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: 3-chloro-4-(trifluoromethyl)phenol. InChIKey: KQFQPAJCFHNHKB-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethyl)phenol |
| InChIKey | KQFQPAJCFHNHKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)