cas: 1017778-52-7 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)phenol, 95%, 95% (CAS 1017778-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H0LJ-250mg |
| cas | 1017778-52-7 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 846.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-(trifluoromethoxy)phenol (CAS 1017778-52-7) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)phenol. InChIKey: GDQVMGRMDBOXLX-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)phenol |
| InChIKey | GDQVMGRMDBOXLX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)O |
Computed by PubChem (NCBI)