cas: 1213790-87-4 — see every product listed under this CAS number, including other names
3-Chloro-5-[(4-methoxybenzyl)oxy]benzonitrile, >97%, >97% (CAS 1213790-87-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J01-1g |
| cas | 1213790-87-4 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1576.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-[(4-methoxyphenyl)methoxy]benzonitrile (CAS 1213790-87-4) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 273.71 g/mol. IUPAC name: 3-chloro-5-[(4-methoxyphenyl)methoxy]benzonitrile. InChIKey: GIOWFZJLEKWQFV-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 3-chloro-5-[(4-methoxyphenyl)methoxy]benzonitrile |
| InChIKey | GIOWFZJLEKWQFV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC(=CC(=C2)C#N)Cl |
Computed by PubChem (NCBI)