CAS 27525-98-0 appears in our catalog under these names: 2-Chloro-3-oxo-n,3-diphenylpropanamide, 95%, 2-Chloro-3-oxo-N,3-diphenylpropanamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-3-oxo-N,3-diphenylpropanamide (CAS 27525-98-0) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 273.71 g/mol. IUPAC name: 2-chloro-3-oxo-N,3-diphenylpropanamide. InChIKey: NGLHXBUDCGSGPT-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 2-chloro-3-oxo-N,3-diphenylpropanamide |
| InChIKey | NGLHXBUDCGSGPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(=O)NC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)