CAS 37799-01-2 is the registry number for 4-(4-Chlorophenyl)-4-azatricyclo[5.2.1.0^{2,6}]dec-8-ene-3,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 37799-01-2) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 273.71 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: HRUJXLSUPUNTBP-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | HRUJXLSUPUNTBP-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)