cas: 1256806-34-4 — see every product listed under this CAS number, including other names
3-Chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one, 98% (CAS 1256806-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519710-100MG |
| cas | 1256806-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 1g | 1736.91 Pln | |
| Fluorochem | 5g | 6157.22 Pln | |
| Fluorochem | 10g | 10410.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CAS 1256806-34-4) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one. InChIKey: DEIJFACUGWLVHU-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| InChIKey | DEIJFACUGWLVHU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)