Products 64037-11-2
CAS 64037-11-2 appears in our catalog under these names: 7-Chloro-2-benzoxazolamine, 95+%, 95+%, 7-chloro-1,3-benzoxazol-2-amine, 95%, 7-chloro-1,3-benzoxazol-2-amine, 95+%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-1,3-benzoxazol-2-amine (CAS 64037-11-2) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 7-chloro-1,3-benzoxazol-2-amine. InChIKey: ZNJCQBBJHFLQAG-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 7-chloro-1,3-benzoxazol-2-amine |
| InChIKey | ZNJCQBBJHFLQAG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=N2)N |
Computed by PubChem (NCBI)