CAS 1706463-17-3 is the registry number for 5-Chloro-2-(cyanomethyl)pyridine 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(5-chloro-1-oxidopyridin-1-ium-2-yl)acetonitrile (CAS 1706463-17-3) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 2-(5-chloro-1-oxidopyridin-1-ium-2-yl)acetonitrile. InChIKey: WUUGVFRQWCGUDP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 2-(5-chloro-1-oxidopyridin-1-ium-2-yl)acetonitrile |
| InChIKey | WUUGVFRQWCGUDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Cl)[O-])CC#N |
Computed by PubChem (NCBI)