cas: 145959-21-3 — see every product listed under this CAS number, including other names
3-Chloro-N-methoxy-N-methylbenzamide, 95% (CAS 145959-21-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223866-1G |
| cas | 145959-21-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 513.38 Pln | |
| Fluorochem | 100g | 1887.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-N-methoxy-N-methylbenzamide (CAS 145959-21-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 3-chloro-N-methoxy-N-methylbenzamide. InChIKey: PIEZXKIADRCNNE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 3-chloro-N-methoxy-N-methylbenzamide |
| InChIKey | PIEZXKIADRCNNE-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=CC=C1)Cl)OC |
Computed by PubChem (NCBI)