3-Chlorophthalonitrile
cas: 76241-79-7 — see every product listed under this CAS number, including other names
3-Chlorophthalonitrile (CAS 76241-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221984-100MG |
| cas | 76241-79-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 2668.87 Pln | |
| Fluorochem | 25g | 12524.77 Pln |
properties
| delivery time | 3-4 weeks |
|---|
3-chlorobenzene-1,2-dicarbonitrile (CAS 76241-79-7) is a chemical compound with the molecular formula C8H3ClN2 and a molecular weight of 162.57 g/mol. IUPAC name: 3-chlorobenzene-1,2-dicarbonitrile. InChIKey: LZQGFZMYLYXXHI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2 |
|---|---|
| Molecular weight | 162.57 g/mol |
| IUPAC name | 3-chlorobenzene-1,2-dicarbonitrile |
| InChIKey | LZQGFZMYLYXXHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#N)C#N |
Computed by PubChem (NCBI)