cas: 1878-71-3 — see every product listed under this CAS number, including other names
3-Cyanobenzeneacetic acid, 98%, 98% (CAS 1878-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GHV-100g |
| cas | 1878-71-3 |
| size | 100g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 3938.00 Pln | |
| Chemat | 500g | 19036.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 10g | 606.80 Pln | |
| Chemat | 25g | 1206.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-cyanophenyl)acetic acid (CAS 1878-71-3) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-(3-cyanophenyl)acetic acid. InChIKey: ZNXMNKGBHYVNNE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(3-cyanophenyl)acetic acid |
| InChIKey | ZNXMNKGBHYVNNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CC(=O)O |
Computed by PubChem (NCBI)