Products 1878-71-3
CAS 1878-71-3 appears in our catalog under these names: 3–Cyanophenylacetic acid, 3-Cyanophenylacetic acid, 3-Cyanophenylacetic acid, 98%, 3-Cyanophenylacetic acid, 95%, 3-Cyanobenzeneacetic acid, 98%, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g, 250mg, 500g.
2-(3-cyanophenyl)acetic acid (CAS 1878-71-3) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-(3-cyanophenyl)acetic acid. InChIKey: ZNXMNKGBHYVNNE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(3-cyanophenyl)acetic acid |
| InChIKey | ZNXMNKGBHYVNNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CC(=O)O |
Computed by PubChem (NCBI)