cas: 24973-50-0 — see every product listed under this CAS number, including other names
3-Cyanobiphenyl, 97% (CAS 24973-50-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F122101-250MG |
| cas | 24973-50-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1356.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-phenylbenzonitrile (CAS 24973-50-0) is a chemical compound with the molecular formula C13H9N and a molecular weight of 179.22 g/mol. IUPAC name: 3-phenylbenzonitrile. InChIKey: SYHJILPZUNKNHQ-UHFFFAOYSA-N.
| Molecular formula | C13H9N |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 3-phenylbenzonitrile |
| InChIKey | SYHJILPZUNKNHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)