CAS 2920-38-9 appears in our catalog under these names: 4–Phenylbenzonitrile, 4-Cyanobiphenyl, 95% , 4-Cyanobiphenyl, >98.0%(GC), 4-Cyanobiphenyl, [1,1'-Biphenyl]-4-carbonitrile 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 500g, 10g, 50g, 5g, 0,1kg, 0,05kg.
4-phenylbenzonitrile (CAS 2920-38-9) is a chemical compound with the molecular formula C13H9N and a molecular weight of 179.22 g/mol. IUPAC name: 4-phenylbenzonitrile. InChIKey: BPMBNLJJRKCCRT-UHFFFAOYSA-N.
| Molecular formula | C13H9N |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-phenylbenzonitrile |
| InChIKey | BPMBNLJJRKCCRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)