cas: 396131-82-1 — see every product listed under this CAS number, including other names
3-Cyanomethylphenylboronic acid, pinacol ester, 98%, 98% (CAS 396131-82-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8SE-1g |
| cas | 396131-82-1 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 396131-82-1) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: LIWPKYSGWSFPEE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | LIWPKYSGWSFPEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC#N |
Computed by PubChem (NCBI)