cas: 1650548-68-7 — see every product listed under this CAS number, including other names
3-Cyclopropyl-6-(Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-1H-Indazole, 98%, 98% (CAS 1650548-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ5C-100mg |
| cas | 1650548-68-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 250mg | 179.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole (CAS 1650548-68-7) is a chemical compound with the molecular formula C16H21BN2O2 and a molecular weight of 284.2 g/mol. IUPAC name: 3-cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole. InChIKey: WJYQDWFSYYQFPF-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 3-cyclopropyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole |
| InChIKey | WJYQDWFSYYQFPF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NNC(=C3C=C2)C4CC4 |
Computed by PubChem (NCBI)